CAS 107389-91-3

4-hydroxy-4-(2-hydroxyethyl)cyclohexanone

Description:

4-Hydroxy-4-(2-hydroxyethyl)cyclohexanone, with the CAS number 107389-91-3, is an organic compound characterized by its cyclohexanone structure, which features a hydroxyl group and a hydroxyethyl substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is soluble in water and various organic solvents, making it versatile for different applications. The presence of multiple hydroxyl groups contributes to its potential as a hydrogen bond donor, influencing its reactivity and interactions with other molecules. This compound may be utilized in various fields, including pharmaceuticals and materials science, due to its functional groups that can participate in chemical reactions such as esterification or oxidation. Additionally, its structural features suggest potential applications in the synthesis of more complex organic molecules. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with exposure.

Formula: C₈H₁₄O₃

InChI: InChI=1/C8H14O3/c9-6-5-8(11)3-1-7(10)2-4-8/h9,11H,1-6H2

SMILES: C1CC(CCC1=O)(CCO)O

Cyclohexanone,4-hydroxy-4-(2-hydroxyethyl)-

CAS: 107389-91-3

Formula: C₈H₁₄O₃

Purity: 96.0%

Molecular weight: 158.1950

Ref: IN-DA007WAR

Cleroindicin B

CAS: 107389-91-3

Cleroindicin B shows weak scavenging action on 2,2-diphenyl-l-picrylhydrazyl and hydroxyl radicals.

Formula: C₈H₁₄O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 158.2

Ref: TM-TN3677

Cleroindicin B

CAS: 107389-91-3

Formula: C₈H₁₄O₃

Purity: 95%~99%

Color and Shape: Oil

Molecular weight: 158.197

Ref: BP-SBP00522

Cleroindicin B

CAS: 107389-91-3

Cleroindicin B is a naturally occurring compound, classified as a phenolic glycoside, which is derived from plants of the Clerodendrum genus. Its bioactive properties are attributed to its unique chemical structure that enables interactions at the molecular level within biological systems. The mode of action of Cleroindicin B involves modulation of specific cellular pathways, potentially influencing enzyme activity and signal transduction processes.

Formula: C₈H₁₄O₃

Purity: Min. 95%

Molecular weight: 158.19 g/mol

Ref: 3D-HEA38991