CAS 107390-08-9: Garcinone D
Description:Garcinone D is a naturally occurring chemical compound classified as a xanthone, which is a type of polyphenolic compound. It is primarily derived from the fruit of the Garcinia mangostana, commonly known as mangosteen. This compound is characterized by its unique structural features, including a fused benzopyranone ring system, which contributes to its biological activity. Garcinone D has garnered interest in the field of medicinal chemistry due to its potential antioxidant, anti-inflammatory, and anticancer properties. Research indicates that it may influence various cellular pathways, making it a subject of investigation for therapeutic applications. Additionally, Garcinone D exhibits solubility in organic solvents, which is typical for many xanthones, but its solubility in water is limited. As with many natural products, the extraction and purification processes can affect its yield and purity, which are critical for further studies and potential applications in pharmaceuticals and nutraceuticals.
Formula:C24H28O7
InChI:InChI=1S/C24H28O7/c1-12(2)6-7-13-15(25)10-18-20(21(13)27)22(28)19-14(8-9-24(3,4)29)23(30-5)16(26)11-17(19)31-18/h6,10-11,25-27,29H,7-9H2,1-5H3
InChI key:InChIKey=TYALNCRUIKOKGP-UHFFFAOYSA-N
SMILES:O=C1C2=C(O)C(=C(O)C=C2OC3=CC(O)=C(OC)C(=C13)CCC(O)(C)C)CC=C(C)C
- Synonyms:
- 1,3,6-Trihydroxy-8-(3-hydroxy-3-methylbutyl)-7-methoxy-2-(3-methyl-2-buten-1-yl)-9H-xanthen-9-one
- 1,3,6-Trihydroxy-8-(3-hydroxy-3-methylbutyl)-7-methoxy-2-(3-methylbut-2-enyl)xanthen-9-one
- 9H-Xanthen-9-one,1,3,6-trihydroxy-8-(3-hydroxy-3-methylbutyl)-7-methoxy-2-(3-methyl-2-butenyl)-
- Garcinone D
- 9H-Xanthen-9-one, 1,3,6-trihydroxy-8-(3-hydroxy-3-methylbutyl)-7-methoxy-2-(3-methyl-2-buten-1-yl)-
