CAS 107393-73-7
:2,3,4,5-Tetrahydro-1H-3-Benzazepin-7-Amine
Description:
2,3,4,5-Tetrahydro-1H-3-benzazepin-7-amine is a bicyclic organic compound characterized by its unique structure, which includes a benzene ring fused to a seven-membered nitrogen-containing ring. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the nitrogen-containing ring, contributing to its stability and reactivity. The amine functional group at the 7-position enhances its potential for hydrogen bonding and reactivity in various chemical reactions. This compound is of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals targeting neurological and psychiatric disorders. Its solubility, stability, and interaction with biological systems can vary based on the presence of substituents and the overall molecular conformation. As with many nitrogen-containing heterocycles, it may exhibit properties such as basicity and the ability to form salts, which can influence its pharmacokinetic and pharmacodynamic profiles. Further studies are often required to fully elucidate its properties and potential applications in drug development.
Formula:C10H14N2
InChI:InChI=1/C10H14N2/c11-10-2-1-8-3-5-12-6-4-9(8)7-10/h1-2,7,12H,3-6,11H2
SMILES:c1cc(cc2CCNCCc12)N
Synonyms:- 1H-3-benzazepin-7-amine, 2,3,4,5-tetrahydro-
- 2,3,4,5-tetrahydro-1H-benzo[d]azepin-7-amine
- 2,3,4,5-Tetrahydro-1H-3-benzazepin-7-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,3,4,5-Tetrahydro-1H-3-benzazepin-7-amine
CAS:Controlled ProductFormula:C10H14N2Color and Shape:NeatMolecular weight:162.23

