
CAS 107393-74-8
:2-Ethyl-1,2,3,4-tetrahydro-7-isoquinolinamine
Description:
2-Ethyl-1,2,3,4-tetrahydro-7-isoquinolinamine, with the CAS number 107393-74-8, is a chemical compound that belongs to the isoquinoline family, characterized by its bicyclic structure. This compound features a tetrahydroisoquinoline core, which is a saturated derivative of isoquinoline, indicating that it has undergone hydrogenation at specific positions. The presence of the ethyl group at the 2-position contributes to its unique properties, potentially influencing its solubility and reactivity. As an amine, it contains a nitrogen atom that can participate in hydrogen bonding, affecting its interactions with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential applications in drug development, particularly in the synthesis of compounds with neuroactive properties. However, specific data on its toxicity, stability, and reactivity would require further investigation through experimental studies and literature review.
Formula:C11H16N2
InChI:InChI=1S/C11H16N2/c1-2-13-6-5-9-3-4-11(12)7-10(9)8-13/h3-4,7H,2,5-6,8,12H2,1H3
InChI key:InChIKey=HXQGLHSLMHBNCR-UHFFFAOYSA-N
SMILES:C(C)N1CC=2C(CC1)=CC=C(N)C2
Synonyms:- 7-Isoquinolinamine, 2-ethyl-1,2,3,4-tetrahydro-
- 2-Ethyl-1,2,3,4-tetrahydro-7-isoquinolinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.