CAS 1074-03-9

2-Hydroxybenzenesulfinic acid

Description:

2-Hydroxybenzenesulfinic acid, also known as salicylsulfinic acid, is an aromatic sulfonic acid characterized by the presence of both a hydroxyl group (-OH) and a sulfinic acid group (-SO2H) attached to a benzene ring. Its molecular structure features a hydroxyl group ortho to the sulfinic acid group, which influences its chemical reactivity and solubility. This compound is typically a white crystalline solid that is soluble in water, making it useful in various applications, including as a reducing agent and in the synthesis of dyes and pharmaceuticals. The presence of the sulfinic acid group imparts unique properties, such as the ability to act as a nucleophile in organic reactions. Additionally, 2-hydroxybenzenesulfinic acid can participate in redox reactions, contributing to its utility in analytical chemistry. Its CAS number, 1074-03-9, is a unique identifier that facilitates the identification and regulation of this chemical in various contexts, including research and industrial applications.

Formula: C₆H₆O₃S

InChI: InChI=1S/C6H6O3S/c7-5-3-1-2-4-6(5)10(8)9/h1-4,7H,(H,8,9)

InChI key: InChIKey=IWJWXGOENTVZGD-UHFFFAOYSA-N

SMILES: S(=O)(O)C1=C(O)C=CC=C1

Synonyms:

• 2-Hydroxybenzenesulfinic acid
• Benzenesulfinic acid, 2-hydroxy-
• 2-Hydroxybenzene-1-sulfinic acid
• Benzenesulfinic acid, o-hydroxy-