CAS 1074-40-4
:2-Methoxy-4,6-dichloropyrimidine
Description:
2-Methoxy-4,6-dichloropyrimidine is an organic compound characterized by its pyrimidine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at positions 1 and 3. This compound features two chlorine substituents at the 4 and 6 positions and a methoxy group (-OCH3) at the 2 position, contributing to its chemical reactivity and properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of chlorine atoms enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The methoxy group can also influence its solubility and polarity, affecting its behavior in different solvents. 2-Methoxy-4,6-dichloropyrimidine is often utilized in the synthesis of pharmaceuticals and agrochemicals, owing to its ability to act as an intermediate in the formation of more complex molecules. Safety data should be consulted for handling, as it may pose health risks if inhaled or ingested.
Formula:C5H4Cl2N2O
InChI:InChI=1/C5H4Cl2N2O/c1-10-5-8-3(6)2-4(7)9-5/h2H,1H3
SMILES:COc1nc(cc(Cl)n1)Cl
Synonyms:- 4,6-Dichloro-2-Methoxy-Pyrimidine
- 4,6-Dichloro-2-Methoxypyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4,6-Dichloro-2-methoxypyrimidine
CAS:Formula:C5H4Cl2N2OPurity:98%Color and Shape:SolidMolecular weight:179.00414,6-Dichloro-2-methoxypyrimidine
CAS:4,6-Dichloro-2-methoxypyrimidineFormula:C5H4Cl2N2OPurity:98%Color and Shape:Pale Yellow SolidMolecular weight:179.00g/mol4,6-Dichloro-2-methoxypyrimidine
CAS:4,6-Dichloro-2-methoxypyrimidine is a chemical that is used as a reagent for research and educational purposes. It has been shown to be an intermediate in the synthesis of various compounds, such as pyrazolo[1,5-a]pyrimidines and 4,6-dichloroimidazo[4,5-b]pyridine. This product can also be used as a building block to synthesize other chemicals with a wide range of properties. 4,6-Dichloro-2-methoxypyrimidine is soluble in many solvents and reacts well with other chemicals.Formula:C5H4Cl2N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:179 g/mol4,6-Dichloro-2-methoxypyrimidine
CAS:Formula:C5H4Cl2N2OPurity:95%Color and Shape:White to light yellow powderMolecular weight:1794,6-Dichloro-2-methoxypyrimidine
CAS:Controlled Product<p>Applications 4,6-Dichloro-2-methoxypyrimidine (cas# 1074-40-4) is a compound useful in organic synthesis.<br></p>Formula:C5H4Cl2N2OColor and Shape:NeatMolecular weight:179.00




