CAS 1074-42-6
:1-Benzylaziridine
Description:
1-Benzylaziridine is a cyclic amine characterized by a three-membered aziridine ring with a benzyl group attached to one of the nitrogen atoms. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its reactivity due to the strained nature of the aziridine ring, which makes it susceptible to nucleophilic attack and ring-opening reactions. The presence of the benzyl group enhances its lipophilicity, influencing its solubility in organic solvents. 1-Benzylaziridine can participate in various chemical reactions, including alkylation and acylation, making it a valuable intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, it exhibits potential biological activity, which has garnered interest in medicinal chemistry. However, handling this compound requires caution due to its reactivity and potential toxicity. Proper safety measures should be observed when working with 1-benzylaziridine in laboratory settings.
Formula:C9H11N
InChI:InChI=1S/C9H11N/c1-2-4-9(5-3-1)8-10-6-7-10/h1-5H,6-8H2
InChI key:InChIKey=CASDNPHWJOQUQX-UHFFFAOYSA-N
SMILES:C(C1=CC=CC=C1)N2CC2
Synonyms:- 1-(Phenylmethyl)aziridine
- 1-Benzylethylenimine
- Aziridine, 1-(phenylmethyl)-
- Aziridine, 1-(phenylmethyl)- (9CI)
- Aziridine, 1-benzyl-
- Aziridine, 1-benzyl- (8CI)
- N-Benzylaziridine
- N-Benzylethylenimine
- Nsc 18610
- 1-Benzylaziridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
