CAS 1074-45-9

6-Methyl-4-pyrimidinecarboxaldehyde oxime

Description:

6-Methyl-4-pyrimidinecarboxaldehyde oxime is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a carboxaldehyde functional group and an oxime group, which is formed by the reaction of the aldehyde with hydroxylamine. The presence of the methyl group at the 6-position of the pyrimidine ring influences its reactivity and solubility properties. Typically, compounds like this exhibit moderate polarity due to the functional groups, making them soluble in polar solvents such as water and alcohols. The oxime functional group can participate in various chemical reactions, including condensation and rearrangement, making it useful in synthetic organic chemistry. Additionally, derivatives of pyrimidine compounds are often studied for their biological activities, including potential pharmaceutical applications. Overall, 6-Methyl-4-pyrimidinecarboxaldehyde oxime is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₆H₇N₃O

InChI: InChI=1S/C6H7N3O/c1-5-2-6(3-9-10)8-4-7-5/h2-4,10H,1H3

InChI key: InChIKey=KZXCEYLTDGSIMU-UHFFFAOYSA-N

SMILES: C(=NO)C=1C=C(C)N=CN1

Synonyms:

• 4-Pyrimidinecarboxaldehyde, 6-methyl-, oxime
• 6-Methyl-4-pyrimidinecarboxaldehyde oxime