CAS 1074-59-5
:1H-Imidazole-5-propanoic acid
Description:
1H-Imidazole-5-propanoic acid, with the CAS number 1074-59-5, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a propanoic acid side chain, contributing to its acidic properties. It is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents, reflecting its polar functional groups. The presence of the imidazole ring allows for potential biological activity, as imidazole derivatives are often involved in various biochemical processes, including enzyme catalysis and as intermediates in metabolic pathways. Additionally, this compound may exhibit buffering capacity due to the carboxylic acid group, making it useful in biochemical applications. Its properties make it relevant in pharmaceutical research, particularly in the development of drugs targeting various biological systems. Overall, 1H-Imidazole-5-propanoic acid is a versatile compound with significant implications in both chemistry and biochemistry.
Formula:C6H8N2O2
InChI:InChI=1S/C6H8N2O2/c9-6(10)2-1-5-3-7-4-8-5/h3-4H,1-2H2,(H,7,8)(H,9,10)
InChI key:InChIKey=ZCKYOWGFRHAZIQ-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C1=CN=CN1
Synonyms:- Imidazole-4-propionic acid
- 1H-Imidazole-4-propanoic acid
- Imidazole-4(or 5)-propionic acid
- 3-(4-Imidazolyl)propionic acid
- 1H-Imidazole-5-propanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Deamino-histidine
CAS:<p>Bachem ID: 4025148.</p>Formula:C6H8N2O2Purity:> 99%Color and Shape:White PowderMolecular weight:140.143-(Imidazol-4-yl)propionic acid
CAS:Formula:C6H8N2O2Purity:97%Color and Shape:SolidMolecular weight:140.1399Ref: IN-DA007EH1
1g141.00€5g533.00€10gTo inquire25gTo inquire10mg29.00€100mg56.00€250mg73.00€500mg116.00€3-(1H-Imidazol-4-yl)propanoic acid
CAS:3-(1H-Imidazol-4-yl)propanoic acidFormula:C6H8N2O2Purity:≥95%Color and Shape: white solidMolecular weight:140.14g/mol3-(1H-Imidazol-5-yl)propanoic Acid
CAS:Formula:C6H8N2O2Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:140.14Imidazole-5-propionic acid
CAS:Imidazole-5-propionic acid (Imidazolylpropionic acid) is a product of histidine metabolism and may involve oxidation or transamination.Formula:C6H8N2O2Purity:99.62%Color and Shape:SolidMolecular weight:140.14Deamino-histidine
CAS:Deamino-histidine (DAH) is a diagnostic marker that can be used to measure the disease activity of inflammatory bowel disease. It is also a marker for tissue damage, as it accumulates in mammalian tissues during inflammation or necrosis. DAH is formed by the hydrolysis of histidine catalyzed by bacterial enzyme arginase, and it can be detected in blood plasma and urine samples. The concentration of DAH correlates with the degree of intestinal inflammation and has been found to be elevated in patients with Crohn's disease or ulcerative colitis.Formula:C6H8N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:140.14 g/mol3-(1H-Imidazol-4-yl)propanoic acid
CAS:Formula:C6H8N2O2Purity:95%Color and Shape:SolidMolecular weight:140.1423-(1H-imidazol-4-yl)propanoic Acid
CAS:<p>Applications 3-(1H-imidazol-4-yl)propanoic acid (cas# 1074-59-5) is a useful research chemical.<br></p>Formula:C6H8N2O2Color and Shape:Off-WhiteMolecular weight:140.13








