CAS 1074-61-9
:(4-Vinylphenyl)methanol
Description:
(4-Vinylphenyl)methanol, with the CAS number 1074-61-9, is an organic compound characterized by the presence of a vinyl group attached to a phenyl ring, along with a hydroxymethyl group. This compound features a phenolic structure, which contributes to its reactivity and potential applications in polymer chemistry and as a monomer in the synthesis of various materials. It is typically a colorless to pale yellow liquid with a moderate boiling point and exhibits solubility in organic solvents. The vinyl group allows for polymerization reactions, making it useful in the production of copolymers and resins. Additionally, the hydroxymethyl group can participate in hydrogen bonding, influencing its physical properties and reactivity. (4-Vinylphenyl)methanol is of interest in research and industrial applications, particularly in the fields of materials science and organic synthesis, where it can serve as a building block for more complex chemical structures. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C9H10O
InChI:InChI=1/C9H10O/c1-2-8-3-5-9(7-10)6-4-8/h2-6,10H,1,7H2
SMILES:C=Cc1ccc(cc1)CO
Synonyms:- P-Vinylbenzyl Alcohol
- 4-Vinylbenzyl Alcohol
- 3-Vinylbenzyl Alcohol
- (4-Vinyl-Phenyl)-Methanol
- (4-Ethenylphenyl)Methanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(4-Vinylphenyl)methanol (~0.1% TBC stabilizer)
CAS:Controlled Product<p>Applications (4-Vinylphenyl)methanol (cas# 1074-61-9) is a useful research chemical.<br></p>Formula:C9H10OColor and Shape:NeatMolecular weight:134.184-Vinylbenzyl alcohol
CAS:4-Vinylbenzyl alcohol is a chlorine-containing organic compound that is used as an intermediate in the production of other chemicals. It is also used as a solvent, plasticizer, and stabilizer. 4-Vinylbenzyl alcohol has been found to be an effective inhibitor of the human liver cytochrome P450 enzyme system. The reaction product with chloride ions forms a stable complex that inhibits the enzyme's active site. This inhibition prevents the conversion of drugs such as acetaminophen (paracetamol) into toxic metabolites.Formula:C9H10OPurity:Min. 95%Color and Shape:Slightly Yellow Clear LiquidMolecular weight:134.18 g/mol(4-Vinylphenyl)methanol
CAS:Formula:C9H10OPurity:95.0%Color and Shape:Liquid, ClearMolecular weight:134.178





