CAS 107400-97-5

4-Chloro-5H-pyrimido[5,4-b]indole hydrochloride

Description:

4-Chloro-5H-pyrimido[5,4-b]indole hydrochloride is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrimidine and indole moieties. This compound typically appears as a solid, often in crystalline form, and is soluble in polar solvents such as water and methanol. The presence of the chlorine atom at the 4-position of the pyrimidine ring contributes to its reactivity and potential biological activity. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of oncology and neurology, where similar structures have shown promise as therapeutic agents. Its synthesis and characterization involve standard organic chemistry techniques, and it is important to handle it with care due to potential toxicity and the need for proper safety protocols in laboratory settings.

Formula: C₁₀H₇Cl₂N₃

InChI: InChI=1/C10H6ClN3.ClH/c11-10-9-8(12-5-13-10)6-3-1-2-4-7(6)14-9;/h1-5,14H;1H

SMILES: c1ccc2c(c1)c1c(c(Cl)ncn1)[nH]2.Cl

Synonyms:

• 4-Chloro-5H-pyrimido[5,4-b]indole hydrochloride (1:1)
• 5H-pyrimido[5,4-b]indole, 4-chloro-, hydrochloride (1:1)
• 4-chloro-5H-pyrimido[5,4-b]indol-1-ium chloride