
CAS 107400-98-6
:3,5-Dihydro-4H-pyrimido[5,4-b]indole-4-thione
Description:
3,5-Dihydro-4H-pyrimido[5,4-b]indole-4-thione is a heterocyclic compound characterized by its unique fused ring structure, which combines elements of pyrimidine and indole. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which can influence its reactivity and potential biological activity. The presence of nitrogen atoms in the pyrimidine and indole rings contributes to its basicity and potential interactions with biological systems. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure allows for potential hydrogen bonding and π-π stacking interactions, which can be significant in drug design and development. Additionally, the compound's solubility and stability can vary based on the presence of substituents and the overall electronic environment. Overall, 3,5-Dihydro-4H-pyrimido[5,4-b]indole-4-thione represents a class of compounds that may have applications in pharmaceuticals or materials science, warranting further investigation into its properties and potential uses.
Formula:C10H7N3S
InChI:InChI=1S/C10H7N3S/c14-10-9-8(11-5-12-10)6-3-1-2-4-7(6)13-9/h1-5,13H,(H,11,12,14)
InChI key:InChIKey=YMNTVDMKBNZRJH-UHFFFAOYSA-N
SMILES:S=C1C2=C(C=3C(N2)=CC=CC3)NC=N1
Synonyms:- 4H-Pyrimido[5,4-b]indole-4-thione, 3,5-dihydro-
- 4H-Pyrimido[5,4-b]indole-4-thione, 1,5-dihydro-
- 2,9-Dihydro-2,4,9-triaza-fluorene-1-thione
- 3,5-Dihydro-4H-pyrimido[5,4-b]indole-4-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.