CymitQuimica logo

CAS 107400-99-7

:

4-(4-Morpholinyl)-5H-pyrimido[5,4-b]indole

Description:
4-(4-Morpholinyl)-5H-pyrimido[5,4-b]indole, with the CAS number 107400-99-7, is a heterocyclic compound characterized by its complex bicyclic structure that incorporates both pyrimidine and indole moieties. This compound features a morpholine group, which contributes to its solubility and potential biological activity. It is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. The presence of nitrogen atoms in its structure suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. Its unique structure may impart specific pharmacological properties, potentially influencing its activity as an inhibitor or modulator in various biochemical pathways. Additionally, the compound's lipophilicity and polar surface area can affect its absorption, distribution, metabolism, and excretion (ADME) properties, which are critical for drug development. Overall, 4-(4-Morpholinyl)-5H-pyrimido[5,4-b]indole represents a class of compounds that may have significant implications in pharmaceutical research.
Formula:C14H14N4O
InChI:InChI=1S/C14H14N4O/c1-2-4-11-10(3-1)12-13(17-11)14(16-9-15-12)18-5-7-19-8-6-18/h1-4,9,17H,5-8H2
InChI key:InChIKey=UISSSHKLLFDNOA-UHFFFAOYSA-N
SMILES:C1=2C(C=3C(N1)=CC=CC3)=NC=NC2N4CCOCC4
Synonyms:
  • 1-Morpholin-4-yl-9H-2,4,9-triaza-fluorene
  • 4-(4-Morpholinyl)-5H-pyrimido[5,4-b]indole
  • 5H-Pyrimido[5,4-b]indole, 4-(4-morpholinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.