
CAS 107401-01-4
:4-Hydrazinyl-5H-pyrimido[5,4-b]indole
Description:
4-Hydrazinyl-5H-pyrimido[5,4-b]indole is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrimidine and indole moieties. This compound features a hydrazine functional group, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents, depending on the specific conditions. The presence of the hydrazinyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as hydrazines are often associated with various biological activities, including antitumor and antimicrobial properties. Additionally, the compound may participate in various chemical reactions, such as condensation and oxidation, making it of interest for synthetic organic chemistry. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require empirical measurement or detailed literature reference for precise values. Overall, 4-Hydrazinyl-5H-pyrimido[5,4-b]indole represents a fascinating subject for further research in both synthetic and medicinal chemistry.
Formula:C10H9N5
InChI:InChI=1S/C10H9N5/c11-15-10-9-8(12-5-13-10)6-3-1-2-4-7(6)14-9/h1-5,14H,11H2,(H,12,13,15)
InChI key:InChIKey=DOCNLHQHJIAUNB-UHFFFAOYSA-N
SMILES:N(N)=C1C2=C(C=3C(N2)=CC=CC3)NC=N1
Synonyms:- 4H-Pyrimido[5,4-b]indol-4-one, 1,5-dihydro-, hydrazone
- 4-Hydrazinyl-5H-pyrimido[5,4-b]indole
- 5H-Pyrimido[5,4-b]indole, 4-hydrazinyl-
- (9H-2,4,9-Triaza-fluoren-1-yl)-hydrazine
- [5H-Pyrimido[5,4-b]indol-4-yl]hydrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.