CAS 107408-16-2
:3-(2-Bromo-Phenyl)-Propionaldehyde
Description:
3-(2-Bromo-Phenyl)-Propionaldehyde, with the CAS number 107408-16-2, is an organic compound characterized by its aldehyde functional group and a brominated phenyl substituent. This compound features a propionaldehyde backbone, which consists of a three-carbon chain terminating in an aldehyde group, while the second carbon is substituted with a 2-bromophenyl group. The presence of the bromine atom introduces notable reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure contributes to its potential applications in various chemical reactions, including nucleophilic additions and coupling reactions. Additionally, the compound's properties, such as boiling point, solubility, and stability, can vary based on environmental conditions and the presence of other functional groups in a reaction mixture. Safety precautions should be observed when handling this compound due to the potential hazards associated with brominated organic compounds.
Formula:C9H9BrO
InChI:InChI=1/C9H9BrO/c10-9-6-2-1-4-8(9)5-3-7-11/h1-2,4,6-7H,3,5H2
SMILES:c1ccc(c(c1)CCC=O)Br
Synonyms:- 3-(2-Bromphenyl)propanal
- Benzenepropanal, 2-Bromo-
- 3-(2-Bromophenyl)Propanal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
