CAS 107430-66-0: 4-[6-(1-adamantyl)-7-hydroxy-2-naphthyl]benzoic acid
Description:4-[6-(1-Adamantyl)-7-hydroxy-2-naphthyl]benzoic acid, with the CAS number 107430-66-0, is a chemical compound that belongs to the class of naphthalene derivatives. It features a complex structure characterized by the presence of an adamantyl group, which contributes to its unique physical and chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic adamantyl moiety. The presence of the hydroxyl group on the naphthalene ring suggests potential for hydrogen bonding, which may influence its reactivity and interactions with other molecules. Additionally, the benzoic acid functional group indicates that it can act as a weak acid, capable of donating protons in solution. This compound has garnered interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and applications in organic synthesis. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement for precise determination.
Formula:C27H26O3
InChI:InChI=1/C27H26O3/c28-25-12-23-10-21(19-1-3-20(4-2-19)26(29)30)5-6-22(23)11-24(25)27-13-16-7-17(14-27)9-18(8-16)15-27/h1-6,10-12,16-18,28H,7-9,13-15H2,(H,29,30)
- Synonyms:
- 4-[6-(Adamantan-1-yl)-7-hydroxy-2-naphthyl]benzoic acid
- Benzoic acid, 4-(7-hydroxy-6-tricyclo[3.3.1.13,7
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | CD 1530 REF: TR-C263155CAS: 107430-66-0 | - - - | 1,568.00 € | Tue 10 Jun 25 |
![]() | CD 1530 REF: 3D-HEA43066CAS: 107430-66-0 | Min. 95% | To inquire | Tue 10 Jun 25 |
![]() | CD 1530 REF: TM-T21686CAS: 107430-66-0 | 98.13% | 75.00 €~1,159.00 € | Tue 17 Jun 25 |

CD 1530
Controlled ProductRef: TR-C263155
500mg | 1,568.00 € |

CD 1530
Ref: 3D-HEA43066
25mg | 1,062.00 € | ||
50mg | 1,477.00 € | ||
100mg | 2,301.00 € |

CD 1530
Ref: TM-T21686
1mg | 75.00 € |