CAS 107430-66-0
:4-[6-(1-adamantyl)-7-hydroxy-2-naphthyl]benzoic acid
Description:
4-[6-(1-Adamantyl)-7-hydroxy-2-naphthyl]benzoic acid, with the CAS number 107430-66-0, is a chemical compound that belongs to the class of naphthalene derivatives. It features a complex structure characterized by the presence of an adamantyl group, which contributes to its unique physical and chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic adamantyl moiety. The presence of the hydroxyl group on the naphthalene ring suggests potential for hydrogen bonding, which may influence its reactivity and interactions with other molecules. Additionally, the benzoic acid functional group indicates that it can act as a weak acid, capable of donating protons in solution. This compound has garnered interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and applications in organic synthesis. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement for precise determination.
Formula:C27H26O3
InChI:InChI=1/C27H26O3/c28-25-12-23-10-21(19-1-3-20(4-2-19)26(29)30)5-6-22(23)11-24(25)27-13-16-7-17(14-27)9-18(8-16)15-27/h1-6,10-12,16-18,28H,7-9,13-15H2,(H,29,30)
SMILES:c1cc(ccc1c1ccc2cc(c(cc2c1)O)C12CC3CC(CC(C3)C2)C1)C(=O)O
Synonyms:- 4-[6-(Adamantan-1-yl)-7-hydroxy-2-naphthyl]benzoic acid
- Benzoic acid, 4-(7-hydroxy-6-tricyclo[3.3.1.13,7
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(7-(Adamantan-1-yl)-6-hydroxynaphthalen-2-yl)benzoic acid
CAS:<p>4-(7-(Adamantan-1-yl)-6-hydroxynaphthalen-2-yl)benzoic acid</p>Purity:98%Molecular weight:398.5g/molCD 1530
CAS:<p>CD 1530 is a synthetic retinoid that is structurally similar to all-trans retinoic acid. CD 1530 stimulates the synthesis of growth factor-β1 and inhibits the release of inflammatory cytokines such as IL-6, TNF-α, and IL-1β. It has been shown to have anticancer activity in vitro and in vivo with efficacy against multiple myeloma, colorectal cancer, pancreatic cancer, and pancreatic adenocarcinoma cell lines. CD 1530 also has anti-inflammatory properties against different types of acute hepatitis viruses (hepatitis A virus, hepatitis B virus, hepatitis C virus) and may be useful for the treatment of hepatic steatosis. The chemical structure of CD 1530 includes a synthetic retinoid backbone that contains a variety of side chains that can be modified to target specific cellular functions.</p>Formula:C27H26O3Purity:Min. 95%Molecular weight:398.49 g/molCD 1530
CAS:<p>CD 1530 is an ARγ agonist (Kd:150 nM) with potential anticancer activity for the study of oral carcinogenesis.</p>Formula:C27H26O3Purity:98.13%Color and Shape:SolidMolecular weight:398.49




