CAS 107452-79-9
:CEFMEPIDIUM CHLORIDE
Description:
Cefmepidium chloride is a synthetic antibiotic belonging to the cephalosporin class, which is characterized by its beta-lactam structure. It is primarily used for its antibacterial properties, effective against a range of Gram-positive and Gram-negative bacteria. The compound exhibits a broad spectrum of activity, making it useful in treating various infections. Cefmepidium chloride is typically administered parenterally and is known for its stability against certain beta-lactamases, which are enzymes produced by bacteria that can inactivate many antibiotics. The substance is soluble in water, which facilitates its use in clinical settings. Its pharmacokinetics involve rapid absorption and distribution in the body, with renal excretion being a significant route for elimination. As with other antibiotics, potential side effects may include allergic reactions, gastrointestinal disturbances, and alterations in normal flora. Overall, cefmepidium chloride represents a valuable option in the arsenal of antimicrobial agents, particularly in the context of increasing antibiotic resistance.
Formula:C23H25ClN6O8S3
InChI:InChI=1/C23H24N6O8S3.ClH/c1-23(2,21(34)35)37-27-14(13-9-39-22(24)25-13)17(30)26-15-18(31)29-16(20(32)33)11(10-40(36)19(15)29)8-38-12-4-6-28(3)7-5-12;/h4-7,9,15,19H,8,10H2,1-3H3,(H4-,24,25,26,30,32,33,34,35);1H/b27-14-;/t15-,19-,40?;/m1./s1
SMILES:CC(C)(C(=O)[O-])O/N=C(/c1csc(=N)[nH]1)\C(=N[C@@H]1C(=O)N2C(=C(C[S+]=c3ccn(C)cc3)CS(=O)[C@H]12)C(=O)O)O.Cl
Synonyms:- Cefmepidium chloride [INN]
- 4-((((6R,7R)-7-(2-(2-Amino-4-thiazolyl)glyoxylamido)-2-carboxy-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-en-3-yl)methyl)thio)-1-methylpyridinium chloride 7(sup 2)-(Z)-(O-(1-carboxy-1-methylethyl)oxime) S-oxide
- Unii-726233N8L3
- 4-((((6R,7R)-7-(2-(2-Amino-4-thiazolyl)glyoxylamido)-2-carboxy-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-en-3-yl)methyl)thio)-1-methylpyridinium chloride 7,2-(Z)-(o-(1-carboxy-1-methylethyl)oxime) S-oxide.
- 4-({[(6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-{[(2-carboxypropan-2-yl)oxy]imino}acetyl]amino}-2-carboxy-5-oxido-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl}sulfanyl)-1-methylpyridinium chloride
- Cefmepidium chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
