CAS 107484-83-3
:1-tert-Butyl-3-isopropyl-5-phenylbiuret
Description:
1-tert-Butyl-3-isopropyl-5-phenylbiuret, with the CAS number 107484-83-3, is a chemical compound that belongs to the biuret class of compounds, which are characterized by the presence of the biuret functional group (–NH–C(=O)–NH–). This substance typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many biuret derivatives. Its structure features a tert-butyl group, an isopropyl group, and a phenyl group, contributing to its hydrophobic characteristics and potentially influencing its biological activity. The presence of multiple functional groups may allow for various interactions in biological systems, making it of interest in fields such as medicinal chemistry and agrochemicals. Additionally, compounds like this can exhibit unique reactivity patterns due to steric hindrance and electronic effects from the bulky substituents. As with many organic compounds, safety data sheets should be consulted for handling and storage information, as well as potential hazards associated with its use.
Formula:C15H23N3O2
InChI:InChI=1/C15H23N3O2/c1-11(2)18(14(20)17-15(3,4)5)13(19)16-12-9-7-6-8-10-12/h6-11H,1-5H3,(H,16,19)(H,17,20)
SMILES:CC(C)N(C(=Nc1ccccc1)O)C(=NC(C)(C)C)O
Synonyms:- 1-tert-Butyl-3-isopropyl-5-phenyl-2-biuret
- 1-(Tert-Butylcarbamoyl)-1-Isopropyl-3-Phenyl-Urea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.