CAS 107485-64-3
:2-Chloro-6-nitrobenzamide
Description:
2-Chloro-6-nitrobenzamide is an organic compound characterized by the presence of a benzene ring substituted with both a chloro group and a nitro group, along with an amide functional group. The chloro group is located at the second position, while the nitro group is at the sixth position of the benzene ring. This compound typically appears as a crystalline solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its reactivity and ability to participate in various chemical reactions. It is generally soluble in organic solvents but may have limited solubility in water. The presence of both electron-withdrawing groups (the nitro and chloro groups) influences its chemical reactivity, making it a useful intermediate in synthetic organic chemistry. Safety data should be consulted for handling, as compounds with nitro and chloro substituents can pose health risks and environmental concerns. Proper storage and disposal methods are essential to mitigate any hazards associated with this compound.
Formula:C7H5ClN2O3
InChI:InChI=1/C7H5ClN2O3/c8-4-2-1-3-5(10(12)13)6(4)7(9)11/h1-3H,(H2,9,11)
SMILES:c1cc(c(c(c1)N(=O)=O)C(=N)O)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
