CAS 107496-54-8

3,3-Difluorocyclobutanecarboxylic acid

Description:

3,3-Difluorocyclobutanecarboxylic acid is a fluorinated organic compound characterized by its cyclobutane ring structure, which is substituted with two fluorine atoms and a carboxylic acid functional group. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The difluoromethyl substituents can influence the compound's reactivity and stability, often enhancing lipophilicity and altering the electronic properties of the molecule. This compound is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex fluorinated compounds. Its unique structure may also affect its physical properties, such as boiling and melting points, solubility, and volatility. Safety data should be consulted for handling and storage, as fluorinated compounds can exhibit specific hazards. Overall, 3,3-Difluorocyclobutanecarboxylic acid represents a valuable compound in the field of synthetic organic chemistry.

Formula: C₅H₆F₂O₂

InChI: InChI=1/C5H6F2O2/c6-5(7)1-3(2-5)4(8)9/h3H,1-2H2,(H,8,9)

SMILES: C1C(CC1(F)F)C(=O)O

Synonyms:

• 3,3-Difluorocyclobutane-1-Carboxylic Acid
• Cyclobutanecarboxylic Acid, 3,3-Difluoro-

3,3-Difluorocyclobutanecarboxylic Acid

CAS: 107496-54-8

Formula: C₅H₆F₂O₂

Purity: >98.0%(GC)(T)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 136.10

Ref: 3B-D5225

3,3-DIFLUOROCYCLOBUTANECARBOXYLIC ACID

CAS: 107496-54-8

Formula: C₅H₆F₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 136.0967

Ref: IN-DA008TPW

3,3-Difluorocyclobutanecarboxylic acid

CAS: 107496-54-8

3,3-Difluorocyclobutanecarboxylic acid

Formula: C₅H₆F₂O₂

Purity: 98%

Color and Shape: pale yellow solid

Molecular weight: 136.10g/mol

Ref: 54-PC400716

3,3-Difluorocyclobutanecarboxylic acid

CAS: 107496-54-8

Formula: C₅H₆F₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 136.098

Ref: 10-F093518