CymitQuimica logo

CAS 1075-25-8

:

Indole-5-methanol

Description:
Indole-5-methanol, with the CAS number 1075-25-8, is an organic compound that features a bicyclic structure characteristic of indole, which consists of a fused benzene and pyrrole ring. This compound is recognized for its hydroxymethyl group (-CH2OH) at the 5-position of the indole ring, which contributes to its chemical reactivity and potential biological activity. Indole derivatives are known for their presence in various natural products and pharmaceuticals, often exhibiting significant pharmacological properties, including antimicrobial and anti-inflammatory effects. Indole-5-methanol is typically a white to off-white solid, and its solubility in polar solvents like water and alcohols makes it versatile for various applications in organic synthesis and medicinal chemistry. The compound can participate in various chemical reactions, including oxidation and substitution, making it a valuable intermediate in the synthesis of more complex molecules. Its study is of interest in fields such as drug development and materials science, where indole derivatives are often explored for their unique properties.
Formula:C9H9NO
InChI:InChI=1/C9H9NO/c11-6-7-1-2-9-8(5-7)3-4-10-9/h1-5,10-11H,6H2
InChI key:ZSHFWQNPJMUBQU-UHFFFAOYSA-N
SMILES:c1cc2c(cc[nH]2)cc1CO
Synonyms:
  • 1H-indol-5-ylmethanol
Found 5 products.