CAS 1075-30-5

1-(bicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethanone

Description:

1-(Bicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethanone, with the CAS number 1075-30-5, is an organic compound characterized by its bicyclic structure, which features a unique arrangement of carbon atoms forming a bicyclo[4.2.0] framework. This compound contains a ketone functional group, indicated by the ethanone moiety, which contributes to its reactivity and potential applications in organic synthesis. The bicyclic system is notable for its conjugated double bonds, which can impart interesting electronic properties and influence the compound's stability and reactivity. The presence of multiple double bonds suggests that it may participate in various chemical reactions, such as electrophilic additions or polymerization. Additionally, the compound's structural complexity may lead to unique physical properties, including specific melting and boiling points, solubility characteristics, and potential optical activity. Overall, 1-(bicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethanone is of interest in the field of organic chemistry for its distinctive structure and potential applications in materials science and medicinal chemistry.

Formula: C₁₀H₁₀O

InChI: InChI=1/C10H10O/c1-7(11)10-6-8-4-2-3-5-9(8)10/h2-5,10H,6H2,1H3

SMILES: CC(=O)C1Cc2ccccc12

1-{Bicyclo[4.2.0]octa-1,3,5-trien-7-yl}ethan-1-one

CAS: 1075-30-5

Versatile small molecule scaffold

Formula: C₁₀H₁₀O

Purity: Min. 95%

Molecular weight: 146.19 g/mol

Ref: 3D-BAA07530