CAS 1075-59-8
:4,6-dimethoxy-1H-1,3,5-triazin-2-one
Description:
4,6-Dimethoxy-1H-1,3,5-triazin-2-one, with the CAS number 1075-59-8, is a heterocyclic organic compound characterized by its triazine ring structure, which consists of three nitrogen atoms and three carbon atoms. This compound features two methoxy (-OCH3) groups attached to the 4 and 6 positions of the triazine ring, contributing to its chemical reactivity and solubility properties. It is typically a white to off-white crystalline solid, and its molecular structure imparts certain stability and reactivity, making it of interest in various chemical applications, including as a potential herbicide or in the synthesis of other organic compounds. The presence of the methoxy groups enhances its solubility in organic solvents, while the triazine core is known for its ability to participate in various chemical reactions, including nucleophilic substitutions. Additionally, this compound may exhibit biological activity, which warrants further investigation in pharmacological contexts. Overall, 4,6-dimethoxy-1H-1,3,5-triazin-2-one is a versatile compound with potential applications in both agricultural and medicinal chemistry.
Formula:C5H7N3O3
InChI:InChI=1/C5H7N3O3/c1-10-4-6-3(9)7-5(8-4)11-2/h1-2H3,(H,6,7,8,9)
SMILES:COc1nc(nc(n1)OC)O
Synonyms:- 4,6-dimethoxy-1,3,5-triazin-2(1H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4,6-DIMETHOXY-1,3,5-TRIAZIN-2(1H)-ONE
CAS:Formula:C5H7N3O3Purity:95%Color and Shape:SolidMolecular weight:157.12744,6-Dimethoxy-1,3,5-triazin-2(1H)-one
CAS:4,6-Dimethoxy-1,3,5-triazin-2(1H)-oneFormula:C5H7N3O3Purity:95%Color and Shape: white powderMolecular weight:157.13g/mol4,6-Dimethoxy-1,3,5-triazin-2(1H)-one
CAS:Controlled ProductFormula:C5H7N3O3Color and Shape:NeatMolecular weight:157.1274,6-Dimethoxy-1H-1,3,5-triazin-2-one
CAS:4,6-Dimethoxy-1H-1,3,5-triazin-2-one is a conjugate of pyridinium with an amide. The compound has been used as a disinfectant for surfaces and in the treatment of wounds. It is also used as a biocide in water treatment. This compound has shown to be effective against Staphylococcus aureus and other bacteria, as well as some fungi. 4,6-Dimethoxy-1H-1,3,5-triazin-2-one can be synthesized from 2-(4'-methoxyphenyl)acetonitrile and chloral hydrate. The compound contains functionalities such as amines and oligosaccharides that are important for its antimicrobial activity.
Formula:C5H7N3O3Purity:Min. 95%Color and Shape:PowderMolecular weight:157.13 g/mol





