
CAS 1075-83-8
:7-Methyl-2-azaspiro[4.4]nonane-1,3-dione
Description:
7-Methyl-2-azaspiro[4.4]nonane-1,3-dione, with the CAS number 1075-83-8, is a chemical compound characterized by its unique spirocyclic structure, which features a nitrogen atom integrated into a bicyclic framework. This compound contains two carbonyl groups (diones) that contribute to its reactivity and potential applications in organic synthesis. The presence of the methyl group at the 7-position influences its steric and electronic properties, making it an interesting candidate for various chemical reactions. Typically, compounds of this nature may exhibit biological activity, which could be explored for pharmaceutical applications. Its structural complexity allows for potential interactions with biological macromolecules, making it a subject of interest in medicinal chemistry. Additionally, the azaspiro structure may impart unique conformational characteristics, affecting its solubility and stability in different solvents. Overall, 7-Methyl-2-azaspiro[4.4]nonane-1,3-dione represents a fascinating area of study within organic and medicinal chemistry due to its distinctive features and potential utility.
Formula:C9H13NO2
InChI:InChI=1S/C9H13NO2/c1-6-2-3-9(4-6)5-7(11)10-8(9)12/h6H,2-5H2,1H3,(H,10,11,12)
InChI key:InChIKey=YAELFPQGXNWYIR-UHFFFAOYSA-N
SMILES:O=C1C2(CC(=O)N1)CCC(C)C2
Synonyms:- 7-Methyl-2-azaspiro[4.4]nonane-1,3-dione
- 2-Azaspiro[4.4]nonane-1,3-dione, 7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.