CAS 1075-89-4: 8-Azaspiro[4.5]decane-7,9-dione
Description:8-Azaspiro[4.5]decane-7,9-dione, with the CAS number 1075-89-4, is a bicyclic compound featuring a spiro structure that incorporates a nitrogen atom within its framework. This compound is characterized by its unique spirocyclic arrangement, which contributes to its potential biological activity and chemical reactivity. The presence of two carbonyl groups (diones) in the structure enhances its reactivity, making it a candidate for various chemical transformations. The nitrogen atom in the azaspiro structure can influence the compound's properties, such as solubility and interaction with biological targets. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the compound's stability, melting point, and solubility can vary based on environmental conditions and the presence of solvents. Overall, 8-Azaspiro[4.5]decane-7,9-dione represents a class of compounds that may have significant implications in synthetic chemistry and drug development.
Formula:C9H13NO2
InChI:InChI=1S/C9H13NO2/c11-7-5-9(3-1-2-4-9)6-8(12)10-7/h1-6H2,(H,10,11,12)
InChI key:InChIKey=YRTHJMQKDCXPAY-UHFFFAOYSA-N
SMILES:O=C1NC(=O)CC2(C1)CCCC2
- Synonyms:
- 1,1-Cyclopentanediacetimide
- 3-Spirocyclopentaneglutarimide
- 4,4-Tetramethyleneglutarimide
- 8-Azaspiro[4,5]decane-7,9-Dione
- 8-Azaspiro[4.5]decane-7,9-dione
- NSC 400092
- β-Spirocyclopentaneglutarimide
- 3,3-Tetramethyleneglutarimide