CAS 107507-53-9
:1-[4-(Trifluoromethyl)-2-thiazolyl]piperazine
Description:
1-[4-(Trifluoromethyl)-2-thiazolyl]piperazine is a chemical compound characterized by its unique structural features, which include a piperazine ring and a thiazole moiety substituted with a trifluoromethyl group. The presence of the trifluoromethyl group enhances the lipophilicity and metabolic stability of the compound, making it of interest in medicinal chemistry. The thiazole ring contributes to its biological activity, often associated with various pharmacological properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the trifluoromethyl group can influence the compound's electronic properties, potentially affecting its reactivity and interaction with other molecules. Overall, 1-[4-(Trifluoromethyl)-2-thiazolyl]piperazine is a compound of interest in research, particularly in the fields of drug discovery and development.
Formula:C8H10F3N3S
InChI:InChI=1S/C8H10F3N3S/c9-8(10,11)6-5-15-7(13-6)14-3-1-12-2-4-14/h5,12H,1-4H2
InChI key:InChIKey=WKUALTYNBYXZGQ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C(SC1)N2CCNCC2
Synonyms:- 1-(4-Trifluoromethylthiazol-2-yl)piperazine
- 1-[4-(Trifluoromethyl)-1,3-Thiazol-2-Yl]Piperazine
- 1-[4-(Trifluoromethyl)-2-thiazolyl]piperazine
- 107507-53-9
- Piperazine, 1-[4-(trifluoromethyl)-2-thiazolyl]-
- 1-(4-Trifluoromethyl-thiazol-2-yl)-piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
