CAS 107534-93-0: 4-[(2S,3R)-4-(1,3-benzodioxol-5-yl)-2,3-dimethylbutyl]-2-methoxyphenol
Description:The chemical substance known as "4-[(2S,3R)-4-(1,3-benzodioxol-5-yl)-2,3-dimethylbutyl]-2-methoxyphenol," with the CAS number 107534-93-0, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a methoxy group (-OCH3) and a phenolic hydroxyl group (-OH) attached to a phenolic ring, contributing to its potential antioxidant properties. The presence of a benzodioxole moiety suggests that it may exhibit unique electronic properties and interactions, which can influence its biological activity. The compound's stereocenters indicate that it may exist in multiple enantiomeric forms, which can significantly affect its pharmacological profile. Additionally, the branched alkyl chain enhances its lipophilicity, potentially impacting its solubility and permeability in biological systems. Overall, this compound may be of interest in medicinal chemistry and pharmacology, particularly in the context of developing therapeutic agents with specific biological activities.
Formula:C20H24O4
InChI:InChI=1S/C20H24O4/c1-13(8-15-4-6-17(21)19(10-15)22-3)14(2)9-16-5-7-18-20(11-16)24-12-23-18/h4-7,10-11,13-14,21H,8-9,12H2,1-3H3/t13-,14+/m0/s1
InChI key:InChIKey=QDDILOVMGWUNGD-UONOGXRCSA-N
SMILES:OC1=CC=C(C=C1OC)CC(C)C(C)CC2=CC=C3OCOC3=C2
- Synonyms:
- (+)-Anwulignan
- Anwuligan
- Macelignan, (+)-
- Phenol, 4-[4-(1,3-benzodioxol-5-yl)-2,3-dimethylbutyl]-2-methoxy-, [S-(R*,S*)]-
- phenol, 4-[(2S,3R)-4-(1,3-benzodioxol-5-yl)-2,3-dimethylbutyl]-2-methoxy-
![4-[(2S,3R)-4-(1,3-benzodioxol-5-yl)-2,3-dimethylbutyl]-2-methoxyphenol](https://static.cymitquimica.com/cas-image/302970-4-2s-3r-4-13-benzodioxol-5-yl-23-dimethylbutyl-2-methoxyphenol.png)
