CAS 107537-94-0
:GALACTOSTATIN
Description:
Galactostatin, with the CAS number 107537-94-0, is a peptide that functions primarily as a neuropeptide and is known for its role in modulating various physiological processes. It is derived from the central nervous system and has been studied for its potential effects on neuroendocrine functions, particularly in relation to the regulation of hormone secretion. Galactostatin exhibits characteristics typical of peptides, including a specific amino acid sequence that determines its biological activity. It is soluble in aqueous solutions and may have a relatively short half-life in biological systems due to enzymatic degradation. Research has indicated that galactostatin may influence metabolic pathways and has potential implications in the study of neurodegenerative diseases and metabolic disorders. Its mechanism of action often involves interaction with specific receptors, leading to downstream signaling effects. As with many peptides, stability and bioavailability can be challenges in therapeutic applications, necessitating further research to explore its full potential in clinical settings.
Formula:C6H13NO5
InChI:InChI=1/C6H13NO5/c8-1-2-3(9)4(10)5(11)6(12)7-2/h2-12H,1H2/t2-,3+,4+,5-,6?/m1/s1
Synonyms:- Galactonojirimycin
- 5-Amino-5-Deoxy-D-Galactopyranose
- 6-(Hydroxymethyl)-2,3,4,6-Peperidinetetrol
- 5-Amino-5-deoxy-D-galactopyranose=Galactostatin
- Galactonojirimycin,6-(Hydroxymethyl)-2,3,4,6-peperidinetetrol
- 5-Amino-5-Deoxygalactopyranose
- (3R,4S,5S,6R)-6-(hydroxymethyl)piperidine-2,3,4,5-tetrol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Galactostatin
CAS:Galactostatin is an inhibitor of β-galactosidase.Formula:C6H13NO5Color and Shape:SolidMolecular weight:179.171Galactostatin
CAS:Galactostatin is a protein synthesis inhibitor that binds to the l-tartaric acid site of the bacterial 30S ribosomal subunit. It inhibits the binding of aminoacyl-tRNA to the ribosome, preventing translation and inhibiting cell growth. Galactostatin has been shown to be effective against HIV infection in mammalian cells. This drug also has a chaperone effect that protects cells from heat or cold stress.Formula:C6H13NO5Purity:Min. 95%Molecular weight:179.17 g/mol


