CAS 107549-16-6

bromo-(2,3-dihydro-1,4-benzodioxin-7-yl)magnesium

Description:

Bromo-(2,3-dihydro-1,4-benzodioxin-7-yl)magnesium, with the CAS number 107549-16-6, is an organomagnesium compound that features a bromo-substituted benzodioxin moiety. This compound typically exhibits characteristics common to organometallics, such as high reactivity, particularly towards electrophiles, due to the presence of the magnesium atom, which can act as a nucleophile. The benzodioxin structure contributes to its potential applications in organic synthesis, particularly in the formation of carbon-carbon bonds. The presence of the bromine atom enhances its reactivity, making it useful in various coupling reactions. Additionally, the compound is likely to be sensitive to moisture and air, necessitating careful handling under inert atmospheres. Its unique structure may also impart specific electronic properties, influencing its behavior in chemical reactions. Overall, bromo-(2,3-dihydro-1,4-benzodioxin-7-yl)magnesium is a valuable reagent in synthetic organic chemistry, particularly in the development of complex molecular architectures.

Formula: C₈H₇BrMgO₂

InChI: InChI=1/C8H7O2.BrH.Mg/c1-2-4-8-7(3-1)9-5-6-10-8;;/h1,3-4H,5-6H2;1H;/q;;+1/p-1/rC8H7BrMgO2/c9-10-6-1-2-7-8(5-6)12-4-3-11-7/h1-2,5H,3-4H2

SMILES: C1=C=CC2C(=C1)OCCO2.Br.[Mg]

Synonyms:

• 3,4-(Ethylenedioxy)phenylmagnesium bromide, 0.5M 2-MeTHF
• (2,3-Dihydro-1,4-benzodioxin-6-yl)magnesium bromide, 0.5 M in THF
• 3,4-(ETHYLENEDIOXY)PHENYLMAGNESIUM BROMIDE