CAS 107551-97-3

5-methyl-2-(propan-2-yl)cyclohexyl beta-D-glucopyranosiduronic acid

Description:

5-Methyl-2-(propan-2-yl)cyclohexyl beta-D-glucopyranosiduronic acid, with the CAS number 107551-97-3, is a complex organic compound characterized by its unique structural features. It contains a cyclohexane ring substituted with a methyl group and an isopropyl group, contributing to its hydrophobic characteristics. The presence of the beta-D-glucopyranosiduronic acid moiety indicates that it is a glycoside, which typically enhances solubility in water and biological activity. This compound may exhibit various functional properties due to the presence of hydroxyl groups and the uronic acid structure, which can participate in hydrogen bonding and interactions with biological macromolecules. Its specific stereochemistry and functional groups suggest potential applications in pharmaceuticals or biochemistry, particularly in areas related to glycosylation and metabolic pathways. However, detailed studies on its biological activity, stability, and reactivity would be necessary to fully understand its potential uses and characteristics in various chemical contexts.

Formula: C₁₆H₂₈O₇

InChI: InChI=1/C16H28O7/c1-7(2)9-5-4-8(3)6-10(9)22-16-13(19)11(17)12(18)14(23-16)15(20)21/h7-14,16-19H,4-6H2,1-3H3,(H,20,21)/t8?,9?,10?,11-,12-,13+,14-,16+/m0/s1

Menthol Glucuronide

CAS: 107551-97-3

Formula: C₁₆H₂₈O₇

Molecular weight: 332.39

Ref: 4Z-M-094004

Menthol-d4 b-D-Glucuronide (Mixture of Diasteromers)

Controlled Product

CAS: 107551-97-3

Stability Very Very Hygroscopic!!!
Applications Labelled DL-Menthol β-D-Glucuronide. DL-Menthol β-D-Glucuronide is a metabolite of DL-Methanol.
References Eccles, R., et al.: J. Pharm. Pharmacol., 46, 618 (1994), Feng, S., et al.: Toxicol. Lett., 173, 101 (2007), Dempsey, D., et al.: Clin. Pharmacol. Ther., 76, 64 (2004),

Formula: C₁₆₂H₄H₂₄O₇

Color and Shape: Neat

Molecular weight: 336.41

Ref: TR-M218907