CAS 107555-93-1

1,2,3,7,8-Pentabromodibenzofuran

Description:

1,2,3,7,8-Pentabromodibenzofuran (CAS 107555-93-1) is a polybrominated dibenzofuran, a class of compounds known for their use as flame retardants. This substance features a complex molecular structure characterized by two fused benzene rings connected by a furan ring, with five bromine atoms substituted at specific positions. The presence of bromine atoms significantly enhances its flame-retardant properties, making it effective in various applications, particularly in plastics and textiles. However, like many brominated compounds, it raises environmental and health concerns due to its persistence, potential for bioaccumulation, and toxicity. Studies have indicated that it may disrupt endocrine functions and pose risks to aquatic life. Its physical properties include a relatively high melting point and low solubility in water, which contribute to its stability in various environments. Regulatory scrutiny has increased around such compounds, leading to restrictions in certain applications to mitigate their environmental impact. Overall, while 1,2,3,7,8-Pentabromodibenzofuran serves important industrial functions, its safety and ecological implications warrant careful consideration.

Formula: C₁₂H₃Br₅O

InChI: InChI=1S/C12H3Br5O/c13-5-1-4-8(2-6(5)14)18-9-3-7(15)11(16)12(17)10(4)9/h1-3H

InChI key: InChIKey=QMKPILUKNSMQTD-UHFFFAOYSA-N

SMILES: BrC1=C2C=3C(OC2=CC(Br)=C1Br)=CC(Br)=C(Br)C3

Synonyms:

• 1,2,3,7,8-Pentabromodibenzo[B,D]Furan
• Dibenzofuran, 1,2,3,7,8-pentabromo-
• 1,2,3,7,8-Pentabromodibenzofuran
• 1,2,3,7,8-Pentabromodibenzofuran