CAS 1075715-57-9
:(αS)-3-Chloro-α-ethylbenzenemethanamine
Description:
(αS)-3-Chloro-α-ethylbenzenemethanamine, identified by its CAS number 1075715-57-9, is a chemical compound characterized by its specific stereochemistry and functional groups. This substance features a chloro substituent on the aromatic ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of an ethyl group and an amine functional group indicates that it may exhibit basic properties and participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The stereochemistry, denoted by the (αS) configuration, suggests that the compound has a specific spatial arrangement that can influence its biological activity and interaction with other molecules. Such characteristics make it of interest in medicinal chemistry and drug development, where the stereochemical configuration can significantly affect pharmacological properties. Additionally, the compound's solubility, stability, and reactivity are influenced by its molecular structure, making it a subject of study in various chemical and pharmaceutical contexts.
Formula:C9H12ClN
InChI:InChI=1S/C9H12ClN/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6,9H,2,11H2,1H3/t9-/m0/s1
InChI key:InChIKey=PLIWCUPYMOIFAV-VIFPVBQESA-N
SMILES:[C@@H](CC)(N)C1=CC(Cl)=CC=C1
Synonyms:- Benzenemethanamine, 3-chloro-α-ethyl-, (αS)-
- (S)-1-(3-Chloro-phenyl)-propylamine
- (αS)-3-Chloro-α-ethylbenzenemethanamine
- (1S)-1-(3-Chlorophenyl)propan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
