CymitQuimica logo

CAS 1075715-58-0

:

(αS)-α-Cyclobutylbenzenemethanamine

Description:
(αS)-α-Cyclobutylbenzenemethanamine, identified by its CAS number 1075715-58-0, is an organic compound characterized by the presence of a cyclobutyl group attached to a benzene ring, with an amine functional group. This compound features a chiral center, which contributes to its stereochemistry, specifically the (αS) configuration. The presence of the cyclobutyl moiety can influence its physical properties, such as boiling and melting points, as well as its solubility in various solvents. The amine group suggests potential basicity and reactivity, allowing for interactions with acids and other electrophiles. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structure may also lead to specific conformational preferences, impacting its behavior in chemical reactions and interactions with biological targets. Overall, (αS)-α-Cyclobutylbenzenemethanamine represents a fascinating subject for further study in organic chemistry and medicinal applications.
Formula:C11H15N
InChI:InChI=1S/C11H15N/c12-11(10-7-4-8-10)9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8,12H2/t11-/m1/s1
InChI key:InChIKey=YVAXXHNMTBNQFD-LLVKDONJSA-N
SMILES:[C@H](N)(C1CCC1)C2=CC=CC=C2
Synonyms:
  • Benzenemethanamine, α-cyclobutyl-, (αS)-
  • (αS)-α-Cyclobutylbenzenemethanamine
  • (S)-Cyclobutyl(phenyl)methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.