CAS 107573-16-0
:benzoylphenylalanyllysine fluoromethane
Description:
Benzoylphenylalanyllysine fluoromethane, identified by the CAS number 107573-16-0, is a synthetic compound that features a complex structure incorporating an amino acid derivative and a fluorinated alkane. The presence of the benzoyl and phenylalanine moieties suggests that it may exhibit properties typical of aromatic compounds, such as stability and potential for π-π interactions. The lysine component introduces basicity and potential for hydrogen bonding due to its amino group. The fluoromethane part of the molecule indicates the presence of fluorine, which can enhance lipophilicity and influence the compound's reactivity and biological activity. This compound may be of interest in pharmaceutical research, particularly in the development of peptide-based drugs or as a biochemical probe. Its specific characteristics, such as solubility, melting point, and reactivity, would depend on its molecular interactions and the environment in which it is studied. Further investigation through experimental methods would be necessary to fully characterize its properties and potential applications.
Formula:C23H30FN3O4
InChI:InChI=1/C22H27N3O4.CH3F/c23-14-8-7-13-18(22(28)29)24-21(27)19(15-16-9-3-1-4-10-16)25-20(26)17-11-5-2-6-12-17;1-2/h1-6,9-12,18-19H,7-8,13-15,23H2,(H,24,27)(H,25,26)(H,28,29);1H3/t18-,19-;/m0./s1
SMILES:c1ccc(cc1)C[C@@H](C(=N[C@@H](CCCCN)C(=O)O)O)N=C(c1ccccc1)O.CF
Synonyms:- Bz-Phe-lys-CH2F
- N-benzoyl-L-phenylalanyl-L-lysine - fluoromethane (1:1)
- Benzoylphenylalanyllysine fluoromethane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Benzoylphenylalanyllysine fluoromethane
CAS:Controlled ProductBenzoylphenylalanyllysine fluoromethane is a competitive anticoagulant that inhibits the action of kallikrein, an enzyme involved in the activation of factor XII. This drug is used to prevent or treat thrombosis and embolism. It has been shown to be effective in vitro against coagulation factors II, VII, IX, X, XI, XII and XIII. Benzoylphenylalanyllysine fluoromethane is not metabolized by cysteine proteinase and does not interact with norvaline.Formula:C23H30FN3O4Purity:Min. 95%Molecular weight:431.5 g/mol
