
CAS 1075757-32-2
:3,5-Difluoro-α-(methoxymethyl)-2-pyridinemethanamine
Description:
3,5-Difluoro-α-(methoxymethyl)-2-pyridinemethanamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of two fluorine atoms at the 3 and 5 positions of the pyridine ring contributes to its unique reactivity and potential biological activity. The α-(methoxymethyl) group indicates that there is a methoxymethyl substituent attached to the nitrogen atom, which can influence the compound's solubility and interaction with biological targets. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its pharmacological profile. The fluorine substituents can enhance lipophilicity and metabolic stability, making it of interest in medicinal chemistry. Overall, the structural features of 3,5-Difluoro-α-(methoxymethyl)-2-pyridinemethanamine suggest potential applications in drug development, particularly in targeting specific biological pathways or receptors.
Formula:C8H10F2N2O
InChI:InChI=1S/C8H10F2N2O/c1-13-4-7(11)8-6(10)2-5(9)3-12-8/h2-3,7H,4,11H2,1H3
InChI key:InChIKey=GZWODYWDPZNKNW-UHFFFAOYSA-N
SMILES:C(COC)(N)C1=C(F)C=C(F)C=N1
Synonyms:- 1-(3,5-Difluoropyridin-2-yl)-2-methoxyethanamine
- 2-Pyridinemethanamine, 3,5-difluoro-α-(methoxymethyl)-
- 3,5-Difluoro-α-(methoxymethyl)-2-pyridinemethanamine
- 1-(3,5-Difluoropyridin-2-yl)-2-methoxyethan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.