CAS 107583-35-7

5-Chloro-6-methyl-1H-indole-2,3-dione

Description:

5-Chloro-6-methyl-1H-indole-2,3-dione, with the CAS number 107583-35-7, is a synthetic organic compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features a chloro substituent at the 5-position and a methyl group at the 6-position of the indole ring, along with a dione functional group at the 2 and 3 positions, which contributes to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chloro and methyl groups can influence its electronic properties and reactivity, making it of interest in various chemical syntheses and potential pharmaceutical applications. Additionally, compounds of this type may exhibit interesting biological activities, including antimicrobial or anticancer properties, although specific biological data would depend on empirical studies. Proper handling and safety measures should be observed due to its chemical nature.

Formula: C₉H₆ClNO₂

InChI: InChI=1S/C9H6ClNO2/c1-4-2-7-5(3-6(4)10)8(12)9(13)11-7/h2-3H,1H3,(H,11,12,13)

InChI key: InChIKey=NWMQLFYENNVRLS-UHFFFAOYSA-N

SMILES: O=C1C=2C(NC1=O)=CC(C)=C(Cl)C2

Synonyms:

• 5-Chloro-6-methyl-1H-indole-2,3-dione
• 1H-Indole-2,3-dione, 5-chloro-6-methyl-