CAS 107585-75-1

2,3-Dihydro-5,7-dihydroxy-3-[(3-hydroxy-4-methoxyphenyl)methyl]-4H-1-benzopyran-4-one

Description:

2,3-Dihydro-5,7-dihydroxy-3-[(3-hydroxy-4-methoxyphenyl)methyl]-4H-1-benzopyran-4-one, with CAS number 107585-75-1, is a flavonoid compound characterized by its complex polyphenolic structure. This substance features a benzopyran core, which is typical of flavonoids, and includes multiple hydroxyl groups that contribute to its antioxidant properties. The presence of methoxy and hydroxy substituents enhances its potential biological activity, including anti-inflammatory and anticancer effects. Its solubility can vary depending on the solvent, and it may exhibit UV absorbance due to its conjugated double bond system, making it useful in various applications, including pharmaceuticals and nutraceuticals. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this flavonoid represents a class of compounds with significant interest in medicinal chemistry and natural product research due to their diverse biological activities and potential health benefits.

Formula: C₁₇H₁₆O₆

InChI: InChI=1S/C17H16O6/c1-22-14-3-2-9(5-12(14)19)4-10-8-23-15-7-11(18)6-13(20)16(15)17(10)21/h2-3,5-7,10,18-20H,4,8H2,1H3

InChI key: InChIKey=WIBOONWRYQFYQJ-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC(O)=CC2O)OCC1CC3=CC(O)=C(OC)C=C3

Synonyms:

• 2,3-Dihydro-5,7-dihydroxy-3-[(3-hydroxy-4-methoxyphenyl)methyl]-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-3-[(3-hydroxy-4-methoxyphenyl)methyl]-
• 3'-Hydroxy-3,9-dihydroeucomin
• -Hydroxy-3,9-dihydroeucomin

2,3-Dihydro-5,7-dihydroxy-3-[(3-hydroxy-4-methoxyphenyl)methyl]-4H-1-benzopyran-4-one

CAS: 107585-75-1

Formula: C₁₇H₁₆O₆

Purity: 98.0%

Color and Shape: Solid

Molecular weight: 316.3053

Ref: IN-DA003AKV

3'-Hydroxy-3,9-dihydroeucomin

CAS: 107585-75-1

3'-Hydroxy-3,9-dihydroeucomin is a natural product of Muscari, Asparagaceae.

Formula: C₁₇H₁₆O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 316.31

Ref: TM-TMA0531

3'-Hydroxy-3,9-dihydroeucomin

CAS: 107585-75-1

Formula: C₁₇H₁₆O₆

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 316.309

Ref: BP-SBP01658

3'-Hydroxy-3,9-dihydroeucomin

CAS: 107585-75-1

3'-Hydroxy-3,9-dihydroeucomin is a specialized metabolite, which is derived from certain plant species, particularly within the Liliaceae family. Structurally, it falls under the category of natural phenolic compounds. The source of 3'-Hydroxy-3,9-dihydroeucomin is typically plants that are known for their bioactive properties, suggesting a role in the plant's defense mechanisms or signaling pathways.

Formula: C₁₇H₁₆O₆

Purity: Min. 95%

Molecular weight: 316.3 g/mol

Ref: 3D-HEA58575