CymitQuimica logo

CAS 107597-46-6

:

2-fluorodopa

Description:
2-Fluorodopa, with the CAS number 107597-46-6, is a fluorinated derivative of the amino acid L-DOPA, which is primarily known for its role in the treatment of Parkinson's disease. This compound features a fluorine atom substituted at the second position of the aromatic ring, which can influence its pharmacological properties and metabolic pathways. 2-Fluorodopa is characterized by its ability to cross the blood-brain barrier, making it a potential candidate for neuroimaging and therapeutic applications. The presence of the fluorine atom may enhance its stability and alter its interaction with biological targets compared to non-fluorinated analogs. In terms of solubility, 2-fluorodopa is typically soluble in polar solvents, which is common for amino acids and their derivatives. Its synthesis often involves the introduction of the fluorine atom through various fluorination methods. Overall, 2-fluorodopa represents an interesting compound in medicinal chemistry, particularly in the context of neurological research and treatment strategies.
Formula:C9H10FNO4
InChI:InChI=1/C9H10FNO4/c10-7-4(3-5(11)9(14)15)1-2-6(12)8(7)13/h1-2,5,12-13H,3,11H2,(H,14,15)
SMILES:c1cc(c(c(c1CC(C(=O)O)N)F)O)O
Synonyms:
  • 2-Fluoro-3-hydroxytyrosine
  • 3,4-Dihydroxy-2-fluorophenylalanine
  • L-Tyrosine, 2-fluoro-3-hydroxy-
  • 2-fluoro-3-hydroxy-L-tyrosine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.