CAS 1076-07-9

Phenylacetic-alpha,alpha-d2 acid

Description:

Phenylacetic-alpha,alpha-d2 acid, with the CAS number 1076-07-9, is a deuterated derivative of phenylacetic acid, which is an aromatic carboxylic acid. This compound features a phenyl group attached to a two-carbon chain that terminates in a carboxylic acid functional group. The deuteration at the alpha position indicates that the hydrogen atoms in that position are replaced with deuterium, a stable isotope of hydrogen, which can be useful in various applications, including NMR spectroscopy and metabolic studies. Phenylacetic acid itself is known for its sweet, floral odor and is used in the synthesis of various pharmaceuticals and fragrances. The presence of deuterium can alter the physical properties slightly, such as melting and boiling points, compared to its non-deuterated counterpart. Additionally, the compound may exhibit unique reactivity patterns due to the kinetic isotope effect, making it valuable in research and analytical chemistry. Overall, Phenylacetic-alpha,alpha-d2 acid serves as an important tool in both synthetic and analytical applications.

Formula: C₈H₆D₂O₂

InChI: InChI=1/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10)/i6D2

SMILES: c1ccc(cc1)C(C(=O)O)([2H])[2H]

Synonyms:

• 2,2-Dideuterio-2-Phenyl-Acetic Acid

PHENYLACETIC-2,2-D2 ACID

CAS: 1076-07-9

Formula: C₈H₈O₂

Molecular weight: 136.1479

Ref: IN-DA008T0A

Phenylacetic-2,2-d2 Acid

Controlled Product

CAS: 1076-07-9

Formula: C₆H₅CD₂COOH

Purity: 98 atom % D

Color and Shape: White Solid.

Molecular weight: 138.06498

Ref: 3U-D0906