CymitQuimica logo

CAS 1076-77-3

:

3-[(2-methylphenyl)amino]propanenitrile

Description:
3-[(2-Methylphenyl)amino]propanenitrile, with the CAS number 1076-77-3, is an organic compound characterized by the presence of a propanenitrile backbone substituted with an amino group and a 2-methylphenyl group. This compound features a nitrile functional group (-C≡N), which contributes to its reactivity and potential applications in organic synthesis. The amino group (-NH2) can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of the aromatic 2-methylphenyl moiety enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. Additionally, the compound may exhibit specific physical properties such as melting and boiling points, which are influenced by its molecular structure and intermolecular interactions. Overall, 3-[(2-methylphenyl)amino]propanenitrile is a significant compound in organic chemistry, with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C10H12N2
InChI:InChI=1/C10H12N2/c1-9-5-2-3-6-10(9)12-8-4-7-11/h2-3,5-6,12H,4,8H2,1H3
SMILES:Cc1ccccc1NCCC#N
Synonyms:
  • Propanenitrile, 3-[(2-Methylphenyl)Amino]-
  • 3-[(2-Methylphenyl)amino]propanenitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.