CAS 107610-23-1

6-fluorohomovanillic acid

Description:

6-Fluorohomovanillic acid is a chemical compound characterized by its structural features, which include a fluorine atom and a homovanillic acid moiety. It is a derivative of homovanillic acid, which is a metabolite of catecholamines and is involved in various biochemical pathways. The presence of the fluorine atom at the 6-position of the aromatic ring can influence the compound's biological activity and pharmacokinetics. Typically, compounds like 6-fluorohomovanillic acid are studied for their potential roles in neuroscience and pharmacology, particularly in relation to dopamine metabolism. The compound is expected to exhibit properties such as solubility in polar solvents, moderate stability under standard conditions, and potential reactivity due to the presence of functional groups. Its specific applications may include research in drug development or as a biochemical probe. As with many fluorinated compounds, it may also exhibit unique interactions with biological systems, making it of interest in medicinal chemistry.

Formula: C₉H₉FO₄

InChI: InChI=1/C9H9FO4/c1-14-8-2-5(3-9(12)13)6(10)4-7(8)11/h2,4,11H,3H2,1H3,(H,12,13)

SMILES: COc1cc(CC(=O)O)c(cc1O)F

Synonyms:

• 6-Flhva
• 6-Fluoro-homovanillic acid
• Benzeneacetic acid, 2-(fluoro-18F)-4-hydroxy-5-methoxy-
• (2-Fluoro-4-Hydroxy-5-Methoxyphenyl)Acetic Acid
• 6-Fluorohomovanillic acid