CAS 107610-63-9

4-Methyl-5-oxo-3-pyrrolidinecarboxamide

Description:

4-Methyl-5-oxo-3-pyrrolidinecarboxamide, with the CAS number 107610-63-9, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. This compound features a ketone functional group (5-oxo) and an amide group (carboxamide), contributing to its reactivity and potential biological activity. The presence of the methyl group at the 4-position indicates that it is a substituted pyrrolidine, which can influence its steric and electronic properties. Typically, compounds of this nature may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, and its solubility and stability can vary based on environmental conditions. As with many organic compounds, the synthesis, purification, and characterization of 4-Methyl-5-oxo-3-pyrrolidinecarboxamide would involve standard organic chemistry techniques, including chromatography and spectroscopy, to confirm its identity and purity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₆H₁₀N₂O₂

InChI: InChI=1S/C6H10N2O2/c1-3-4(5(7)9)2-8-6(3)10/h3-4H,2H2,1H3,(H2,7,9)(H,8,10)

InChI key: InChIKey=NOXIXMRINKMTPQ-UHFFFAOYSA-N

SMILES: C(N)(=O)C1C(C)C(=O)NC1

Synonyms:

• 4-Methyl-5-oxo-3-pyrrolidinecarboxamide
• 3-Pyrrolidinecarboxamide, 4-methyl-5-oxo-