CAS 1076196-98-9
:5-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2,4-dimethoxybenzoic acid
Description:
5-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2,4-dimethoxybenzoic acid, with CAS number 1076196-98-9, is a chemical compound characterized by its complex structure that includes a benzoic acid moiety substituted with methoxy groups and a fluorenylmethoxycarbonyl (Fmoc) protecting group. This compound is typically used in peptide synthesis as a protective group for amino acids, facilitating the selective modification of amino functionalities. The presence of the Fmoc group allows for easy removal under basic conditions, making it a valuable tool in solid-phase peptide synthesis. The methoxy substituents enhance the compound's lipophilicity and may influence its solubility and reactivity. Additionally, the compound's structure suggests potential applications in medicinal chemistry and materials science, particularly in the development of novel pharmaceuticals or polymeric materials. Its stability and reactivity profile are important for its utility in synthetic applications, and it is typically handled under standard laboratory conditions with appropriate safety measures.
Formula:C24H21NO6
InChI:InChI=1S/C24H21NO6/c1-29-21-12-22(30-2)20(11-18(21)23(26)27)25-24(28)31-13-19-16-9-5-3-7-14(16)15-8-4-6-10-17(15)19/h3-12,19H,13H2,1-2H3,(H,25,28)(H,26,27)
InChI key:InChIKey=XBMMIJUPPGWWFA-UHFFFAOYSA-N
SMILES:C(OC(NC1=C(OC)C=C(OC)C(C(O)=O)=C1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:- Benzoic acid, 5-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2,4-dimethoxy-
- 5-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2,4-dimethoxybenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.