CAS 1076197-30-2

(5-Amino-1-phenyl-1H-pyrazol-3-yl)-1-piperidinylmethanone

Description:

(5-Amino-1-phenyl-1H-pyrazol-3-yl)-1-piperidinylmethanone, identified by its CAS number 1076197-30-2, is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a piperidine moiety. The presence of an amino group at the 5-position of the pyrazole contributes to its potential reactivity and biological activity. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in polar solvents, depending on its functional groups. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the pyrazole and piperidine rings, which are common in various bioactive compounds. The compound's specific interactions, stability, and reactivity can be influenced by factors such as pH and temperature, making it of interest for further research in drug design and synthesis. Overall, its unique characteristics position it as a candidate for exploration in various chemical and biological contexts.

Formula: C₁₅H₁₈N₄O

InChI: InChI=1S/C15H18N4O/c16-14-11-13(15(20)18-9-5-2-6-10-18)17-19(14)12-7-3-1-4-8-12/h1,3-4,7-8,11H,2,5-6,9-10,16H2

InChI key: InChIKey=QHJGAQCMEUGHEG-UHFFFAOYSA-N

SMILES: NC=1N(N=C(C(=O)N2CCCCC2)C1)C3=CC=CC=C3

Synonyms:

• Methanone, (5-amino-1-phenyl-1H-pyrazol-3-yl)-1-piperidinyl-
• (5-Amino-1-phenyl-1H-pyrazol-3-yl)-1-piperidinylmethanone

(5-Amino-1-phenyl-1H-pyrazol-3-yl)(piperidin-1-yl)methanone

CAS: 1076197-30-2

Formula: C₁₅H₁₈N₄O

Molecular weight: 270.3296

Ref: IN-DA008XLB

(Piperidin-1-yl)methanone

CAS: 1076197-30-2

Piperidin-1-ylmethanone is a research tool that belongs to the class of activators. It is used in cell biology as a ligand for receptor binding and ion channels. The chemical name for piperidin-1-ylmethanone is (4aS,12bS)-2-(1H-benzimidazol-2-yl)pentanedioic acid methyl ester. Other names for this compound are: 2-[(4aS,12bS)-2-(1H-benzimidazol-2-yl)pentanedioic acid]methyl ester; 4aS,12bS)-2-(1H-benzimidazol-2-yl)pentanedioic acid methyl ester; 4aR,12bR)-2-(1H-benzimidazol-2-yl)pentanedioic acid methyl es

Formula: C₁₅H₁₈N₄O

Purity: Min. 95%

Molecular weight: 270.33 g/mol

Ref: 3D-BTB19730