CymitQuimica logo

CAS 1076197-59-5

:

1,7-Dihydro-4H-pyrrolo[2,3-b]pyridin-4-one

Description:
1,7-Dihydro-4H-pyrrolo[2,3-b]pyridin-4-one is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. This compound features a bicyclic structure that contributes to its unique chemical properties. It typically exhibits a range of functional groups, including a carbonyl group, which can influence its reactivity and potential applications in medicinal chemistry. The presence of nitrogen atoms in the ring structure can enhance its ability to form hydrogen bonds, making it a candidate for various biological activities. This compound may also display interesting electronic properties due to the conjugated system within its structure. Its potential applications could include roles as intermediates in organic synthesis or as pharmacophores in drug development, particularly in targeting specific biological pathways. As with many heterocycles, the stability and reactivity of 1,7-dihydro-4H-pyrrolo[2,3-b]pyridin-4-one can be influenced by substituents on the ring, which can modify its physical and chemical properties.
Formula:C7H6N2O
InChI:InChI=1S/C7H6N2O/c10-6-2-4-9-7-5(6)1-3-8-7/h1-4H,(H2,8,9,10)
InChI key:InChIKey=IXIGMDXJXKDZOF-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC=C1)NC=C2
Synonyms:
  • 1,7-Dihydro-4H-pyrrolo[2,3-b]pyridin-4-one
  • 4H-Pyrrolo[2,3-b]pyridin-4-one, 1,7-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.