CAS 1076198-04-3

Ethyl 2-[(diethylamino)thioxomethoxy]benzeneacetate

Description:

Ethyl 2-[(diethylamino)thioxomethoxy]benzeneacetate, identified by its CAS number 1076198-04-3, is a chemical compound that features a complex structure incorporating an ethyl ester group, a thioxomethoxy moiety, and a diethylamino functional group. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique functional groups that may influence biological activity. The presence of the thioxomethoxy group suggests possible reactivity and interactions with biological targets, while the diethylamino group may enhance solubility and bioavailability. Ethyl 2-[(diethylamino)thioxomethoxy]benzeneacetate may exhibit properties such as moderate polarity, which can affect its distribution in biological systems. Additionally, the compound's stability, reactivity, and potential toxicity would need to be evaluated in the context of its intended use. Overall, this compound represents a class of organic molecules that could be of interest in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₅H₂₁NO₃S

InChI: InChI=1S/C15H21NO3S/c1-4-16(5-2)15(20)19-13-10-8-7-9-12(13)11-14(17)18-6-3/h7-10H,4-6,11H2,1-3H3

InChI key: InChIKey=CWPJDOYYUFVONE-UHFFFAOYSA-N

SMILES: O(C(N(CC)CC)=S)C1=C(CC(OCC)=O)C=CC=C1

Synonyms:

• Ethyl 2-[(diethylamino)thioxomethoxy]benzeneacetate
• Benzeneacetic acid, 2-[(diethylamino)thioxomethoxy]-, ethyl ester

Ethyl [2-Diethylaminothiocarboxyl)]phenylacetate

Controlled Product

CAS: 1076198-04-3

Formula: C₁₅H₂₁NO₃S

Color and Shape: Neat

Molecular weight: 295.4

Ref: TR-E916450