CymitQuimica logo

CAS 1076198-05-4

:

Ethyl 2,2-difluoro-2-mercaptoacetate

Description:
Ethyl 2,2-difluoro-2-mercaptoacetate is a chemical compound characterized by the presence of both fluorine and thiol functional groups. It features a mercapto (–SH) group, which imparts nucleophilic properties, making it reactive in various chemical reactions, particularly in the formation of disulfides or in substitution reactions. The difluoro substituents enhance its electrophilic character, potentially increasing its reactivity towards nucleophiles. This compound is typically a colorless to pale yellow liquid, and its molecular structure includes an ethyl ester group, contributing to its solubility in organic solvents. Ethyl 2,2-difluoro-2-mercaptoacetate may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its unique reactivity profile. Safety considerations should be taken into account, as compounds containing thiol groups can be malodorous and may pose health risks if not handled properly. Overall, its distinctive chemical properties make it a valuable intermediate in various chemical syntheses.
Formula:C4H6F2O2S
InChI:InChI=1S/C4H6F2O2S/c1-2-8-3(7)4(5,6)9/h9H,2H2,1H3
InChI key:InChIKey=LJLQSFIWPSUAAD-UHFFFAOYSA-N
SMILES:C(C(F)(F)S)(OCC)=O
Synonyms:
  • Ethyl 2,2-difluoro-2-mercaptoacetate
  • Acetic acid, 2,2-difluoro-2-mercapto-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.