CAS 1076198-06-5

Ethyl 2-hydroxy-β-oxo-4-(phenylmethoxy)benzenepropanoate

Description:

Ethyl 2-hydroxy-β-oxo-4-(phenylmethoxy)benzenepropanoate, identified by its CAS number 1076198-06-5, is an organic compound characterized by its complex structure, which includes an ethyl ester functional group, a hydroxyl group, and a phenylmethoxy substituent. This compound typically exhibits properties associated with esters, such as being relatively non-polar, which influences its solubility in organic solvents while being less soluble in water. The presence of the hydroxyl group contributes to potential hydrogen bonding, affecting its reactivity and interaction with other molecules. Additionally, the β-oxo group suggests that it may participate in various chemical reactions, including condensation and oxidation. Ethyl 2-hydroxy-β-oxo-4-(phenylmethoxy)benzenepropanoate may find applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex molecules. Its specific characteristics, such as melting point, boiling point, and reactivity, would depend on the precise conditions and environment in which it is studied.

Formula: C₁₈H₁₈O₅

InChI: InChI=1S/C18H18O5/c1-2-22-18(21)11-17(20)15-9-8-14(10-16(15)19)23-12-13-6-4-3-5-7-13/h3-10,19H,2,11-12H2,1H3

InChI key: InChIKey=XEKOBMBXJCOCPI-UHFFFAOYSA-N

SMILES: C(CC(OCC)=O)(=O)C1=C(O)C=C(OCC2=CC=CC=C2)C=C1

Synonyms:

• Ethyl 2-hydroxy-β-oxo-4-(phenylmethoxy)benzenepropanoate
• Benzenepropanoic acid, 2-hydroxy-β-oxo-4-(phenylmethoxy)-, ethyl ester