CAS 1076198-18-9
:N-[[(Hexahydrocyclopenta[c]pyrrol-2(1H)-yl)amino]carbonyl]-2-methylbenzenesulfonamide
Description:
N-[[(Hexahydrocyclopenta[c]pyrrol-2(1H)-yl)amino]carbonyl]-2-methylbenzenesulfonamide is a chemical compound characterized by its complex structure, which includes a sulfonamide functional group, an amide linkage, and a bicyclic amine. The presence of the hexahydrocyclopenta[c]pyrrole moiety contributes to its potential biological activity, as this structure is often associated with various pharmacological properties. The sulfonamide group is known for its role in medicinal chemistry, particularly in the development of antibiotics and other therapeutic agents. This compound may exhibit solubility in polar solvents due to the presence of the sulfonamide and amide functionalities, while its lipophilic bicyclic structure may enhance membrane permeability. Additionally, the compound's potential interactions with biological targets could be influenced by its stereochemistry and functional groups, making it a candidate for further investigation in drug discovery and development. As with many complex organic compounds, its stability, reactivity, and biological activity would depend on specific environmental conditions and the presence of other chemical entities.
Formula:C15H21N3O3S
InChI:InChI=1S/C15H21N3O3S/c1-11-5-2-3-8-14(11)22(20,21)17-15(19)16-18-9-12-6-4-7-13(12)10-18/h2-3,5,8,12-13H,4,6-7,9-10H2,1H3,(H2,16,17,19)
InChI key:InChIKey=XLSAYFQNZDWDHT-UHFFFAOYSA-N
SMILES:N(C(NS(=O)(=O)C1=C(C)C=CC=C1)=O)N2CC3C(C2)CCC3
Synonyms:- Benzenesulfonamide, N-[[(hexahydrocyclopenta[c]pyrrol-2(1H)-yl)amino]carbonyl]-2-methyl-
- N-[[(Hexahydrocyclopenta[c]pyrrol-2(1H)-yl)amino]carbonyl]-2-methylbenzenesulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Gliclazide EP Impurity F
CAS:Formula:C15H21N3O3SColor and Shape:White To Off-White SolidMolecular weight:323.411-(Hexahydrocyclopenta[c]pyrrol-2(1H)-yl)-3-[(2-methylphenyl)sulphonyl]urea
CAS:Controlled ProductFormula:C15H21N3O3SColor and Shape:NeatMolecular weight:323.41ortho Gliclazide
CAS:Applications Impurity of Gliclazide (G409875).
References Hisashi, M., et al.: Eur. J. Drug Metab. Pharmacokinet., 8, 117 (1983),Formula:C15H21N3O3SColor and Shape:WhiteMolecular weight:323.41Gliclazide impurity F
CAS:Gliclazide is a sulfonylurea drug that is used to treat type 2 diabetes. The impurity F, which is an impurity standard, can be synthesized by reacting 1-chloro-2,6-difluoroaniline with sodium methoxide in methanol. It is also an API impurity found in the synthesis of gliclazide and can be custom synthesized for research and development purposes. Gliclazide impurity F has a CAS number of 1076198-18-9 and the molecular formula C8H4ClF3NOS. This product has a purity of >99% and is classified as synthetic. It has been shown to have pharmacopoeia activity and can also be used for niche applications such as drug development.Formula:C15H21N3O3SPurity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:323.41 g/mol







