CAS 1076198-26-9
:9-(Hydroxymethyl)dibenz[cd,g]indazol-6(2H)-one
Description:
9-(Hydroxymethyl)dibenz[cd,g]indazol-6(2H)-one is a chemical compound characterized by its complex polycyclic structure, which includes two fused benzene rings and an indazole moiety. This compound features a hydroxymethyl group, which contributes to its reactivity and potential for forming hydrogen bonds, enhancing its solubility in polar solvents. The presence of the indazol-6(2H)-one structure suggests that it may exhibit interesting biological activities, potentially acting as a pharmacophore in medicinal chemistry. Its molecular framework allows for various interactions with biological targets, making it a candidate for research in drug development. The compound's CAS number, 1076198-26-9, serves as a unique identifier in chemical databases, facilitating its study and application in various fields, including organic synthesis and material science. Overall, the characteristics of this compound highlight its potential utility in both academic research and industrial applications, particularly in the development of novel therapeutic agents.
Formula:C15H10N2O2
InChI:InChI=1S/C15H10N2O2/c18-7-8-4-5-9-11(6-8)14-13-10(15(9)19)2-1-3-12(13)16-17-14/h1-6,18H,7H2,(H,16,17)
InChI key:InChIKey=IQLVKTRJFRLJGK-UHFFFAOYSA-N
SMILES:O=C1C=2C=3C(C=4C1=CC=C(CO)C4)=NNC3C=CC2
Synonyms:- 9-(Hydroxymethyl)dibenz[cd,g]indazol-6(2H)-one
- Dibenz[cd,g]indazol-6(2H)-one, 9-(hydroxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.